C24H32O5 — CID 87233906
4-[(4Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,4-dioxobutanoic acid (PubChem CID 87233906) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[(4Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,4-dioxobutanoic acid.
| Compound Name | 4-[(4Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 87233906 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-[(4Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-3,4-dioxobutanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=C/C=C\C(C)=CCOC(=O)C(=O)CC(=O)O |
| InChI | InChI=1S/C24H32O5/c1-17(11-12-20-19(3)10-7-14-24(20,4)5)8-6-9-18(2)13-15-29-23(28)21(25)16-22(26)27/h6,8-9,11-13H,7,10,14-16H2,1-5H3,(H,26,27)/b9-6-,12-11?,17-8?,18-13? |
| InChIKey | SOCXGTVWBNOEQC-AFCRYGKHSA-N |
| XLogP | 5.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|