C17H26O2 — CID 73097224
[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] acetate (PubChem CID 73097224) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is [3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] acetate.
| Compound Name | [3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] acetate |
|---|---|
| PubChem CID | 73097224 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienyl] acetate |
| SMILES | CC(=O)OCC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C17H26O2/c1-13(10-12-19-15(3)18)8-9-16-14(2)7-6-11-17(16,4)5/h8-10H,6-7,11-12H2,1-5H3 |
| InChIKey | HSKLNRJFWBXQNW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|