C22H33BrO2 — CID 11112339
[(2Z,4E,6S,7R,8E)-6-bromo-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate (PubChem CID 11112339) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is [(2Z,4E,6S,7R,8E)-6-bromo-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate.
| Compound Name | [(2Z,4E,6S,7R,8E)-6-bromo-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate |
|---|---|
| PubChem CID | 11112339 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [(2Z,4E,6S,7R,8E)-6-bromo-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,8-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(C)\C=C\[C@H](Br)[C@H](C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H33BrO2/c1-16(13-15-25-19(4)24)9-12-21(23)18(3)10-11-20-17(2)8-7-14-22(20,5)6/h9-13,18,21H,7-8,14-15H2,1-6H3/b11-10+,12-9+,16-13-/t18-,21+/m1/s1 |
| InChIKey | LYLDVNKFOJOCMY-FWIKKAAPSA-N |
| XLogP | 6.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|