C24H36O5 — CID 173290118
butanedioic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol (PubChem CID 173290118) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is butanedioic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol.
| Compound Name | butanedioic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
|---|---|
| PubChem CID | 173290118 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | butanedioic acid;3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCO.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C20H30O.C4H6O4/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;5-3(6)1-2-4(7)8/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | SEESZSRUGCTUBF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|