C25H36O4 — CID 130234578
2-[(6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pentanedioic acid (PubChem CID 130234578) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[(6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pentanedioic acid.
| Compound Name | 2-[(6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pentanedioic acid |
|---|---|
| PubChem CID | 130234578 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(6Z)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]pentanedioic acid |
| SMILES | CC(C=C/C=C(/C)C=CC1=C(C)CCCC1(C)C)=CCC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H36O4/c1-18(11-13-21(24(28)29)14-16-23(26)27)8-6-9-19(2)12-15-22-20(3)10-7-17-25(22,4)5/h6,8-9,11-12,15,21H,7,10,13-14,16-17H2,1-5H3,(H,26,27)(H,28,29)/b8-6?,15-12?,18-11?,19-9- |
| InChIKey | IZZOZICABFBBKV-FTZFNVNRSA-N |
| XLogP | 6.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|