C38H60O2 — CID 54238442
2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]octadeca-9,12-dienoic acid (PubChem CID 54238442) has the molecular formula C38H60O2 and a molecular weight of 548.90 g/mol. Its IUPAC name is 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]octadeca-9,12-dienoic acid.
| Compound Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 54238442 |
| Molecular Formula | C38H60O2 |
| Molecular Weight | 548.90 g/mol |
| Exact Mass | 548.46 |
| IUPAC Name | 2-[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl]octadeca-9,12-dienoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCC(CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C)C(=O)O |
| InChI | InChI=1S/C38H60O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-35(37(39)40)29-27-32(2)23-21-24-33(3)28-30-36-34(4)25-22-31-38(36,5)6/h11-12,14-15,21,23-24,27-28,30,35H,7-10,13,16-20,22,25-26,29,31H2,1-6H3,(H,39,40) |
| InChIKey | QOGCDAKBABIDET-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.90 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|