C38H58O3 — CID 173087203
[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 173087203) has the molecular formula C38H58O3 and a molecular weight of 562.88 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 173087203 |
| Molecular Formula | C38H58O3 |
| Molecular Weight | 562.88 g/mol |
| Exact Mass | 562.44 |
| IUPAC Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C38H58O3/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27-36(39)41-37(40)31-33(3)25-22-24-32(2)28-29-35-34(4)26-23-30-38(35,5)6/h11-12,14-15,22,24-25,28-29,31H,7-10,13,16-21,23,26-27,30H2,1-6H3/b12-11-,15-14-,25-22?,29-28?,32-24?,33-31? |
| InChIKey | NSPYSIMRMHHAAV-LAHWBWSXSA-N |
| XLogP | 11.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.88 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|