C40H62O5 — CID 87603032
acetyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;(9Z,12Z)-octadeca-9,12-dienoic acid (PubChem CID 87603032) has the molecular formula C40H62O5 and a molecular weight of 622.93 g/mol. Its IUPAC name is acetyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;(9Z,12Z)-octadeca-9,12-dienoic acid.
| Compound Name | acetyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;(9Z,12Z)-octadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 87603032 |
| Molecular Formula | C40H62O5 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 622.46 |
| IUPAC Name | acetyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate;(9Z,12Z)-octadeca-9,12-dienoic acid |
| SMILES | CC(=O)OC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C22H30O3.C18H32O2/c1-16(9-7-10-17(2)15-21(24)25-19(4)23)12-13-20-18(3)11-8-14-22(20,5)6;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7,9-10,12-13,15H,8,11,14H2,1-6H3;6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b10-7+,13-12+,16-9+,17-15+;7-6-,10-9- |
| InChIKey | SQEHLZHIXGKOOV-CLTCZVJHSA-N |
| XLogP | 11.49 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|