C36H60O3 — CID 175595647
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol;(Z)-hexadec-9-enoic acid (PubChem CID 175595647) has the molecular formula C36H60O3 and a molecular weight of 540.87 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol;(Z)-hexadec-9-enoic acid.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol;(Z)-hexadec-9-enoic acid |
|---|---|
| PubChem CID | 175595647 |
| Molecular Formula | C36H60O3 |
| Molecular Weight | 540.87 g/mol |
| Exact Mass | 540.45 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol;(Z)-hexadec-9-enoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/CO)C(C)(C)CCC1.CCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C20H30O.C16H30O2/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3;7-8H,2-6,9-15H2,1H3,(H,17,18)/b9-6+,12-11+,16-8+,17-13+;8-7- |
| InChIKey | LVXMBOWHGVEPNV-RZIHKJKVSA-N |
| XLogP | 10.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.87 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|