C22H32O3 — CID 54106493
2-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid (PubChem CID 54106493) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid.
| Compound Name | 2-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid |
|---|---|
| PubChem CID | 54106493 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-hydroxy-5,9-dimethyl-11-(2,6,6-trimethylcyclohexen-1-yl)undeca-4,6,8,10-tetraenoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCC(O)C(=O)O |
| InChI | InChI=1S/C22H32O3/c1-16(8-6-9-17(2)12-14-20(23)21(24)25)11-13-19-18(3)10-7-15-22(19,4)5/h6,8-9,11-13,20,23H,7,10,14-15H2,1-5H3,(H,24,25) |
| InChIKey | NECSATNWOWCXEJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|