C29H36O5 — CID 56640675
[2-[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 56640675) has the molecular formula C29H36O5 and a molecular weight of 464.60 g/mol. Its IUPAC name is [2-[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 56640675 |
| Molecular Formula | C29H36O5 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [2-[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoxy]-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C/COC(=O)COC(=O)c2ccccc2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H36O5/c1-21(15-16-25-23(3)12-9-18-29(25,4)5)10-8-11-22(2)17-19-33-27(31)20-34-28(32)24-13-6-7-14-26(24)30/h6-8,10-11,13-17,30H,9,12,18-20H2,1-5H3/b11-8+,16-15+,21-10-,22-17- |
| InChIKey | SELPSYVYFAVYMK-KQQMWOSUSA-N |
| XLogP | 6.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|