C29H37NO3 — CID 90477858
(2S)-2-[[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phenylpropanoic acid (PubChem CID 90477858) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is (2S)-2-[[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90477858 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (2S)-2-[[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C/C(=O)N[C@@H](Cc2ccccc2)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H37NO3/c1-21(16-17-25-23(3)13-10-18-29(25,4)5)11-9-12-22(2)19-27(31)30-26(28(32)33)20-24-14-7-6-8-15-24/h6-9,11-12,14-17,19,26H,10,13,18,20H2,1-5H3,(H,30,31)(H,32,33)/b12-9+,17-16+,21-11-,22-19-/t26-/m0/s1 |
| InChIKey | KQFROUCLXDASFA-GPQYOMPFSA-N |
| XLogP | 6.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|