C24H36N2O5S — CID 11754199
4-amino-3-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-oxobutane-1-sulfonic acid (PubChem CID 11754199) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is 4-amino-3-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-amino-3-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 11754199 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 4-amino-3-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-oxobutane-1-sulfonic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC(CCS(=O)(=O)O)C(N)=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H36N2O5S/c1-17(11-12-20-19(3)10-7-14-24(20,4)5)8-6-9-18(2)16-22(27)26-21(23(25)28)13-15-32(29,30)31/h6,8-9,11-12,16,21H,7,10,13-15H2,1-5H3,(H2,25,28)(H,26,27)(H,29,30,31)/b9-6+,12-11+,17-8+,18-16+ |
| InChIKey | HDJKYMFJCYVNRA-LYKFAKFTSA-N |
| XLogP | 3.77 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|