C24H35NO3 — CID 11617948
methyl 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoate (PubChem CID 11617948) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is methyl 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoate.
| Compound Name | methyl 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoate |
|---|---|
| PubChem CID | 11617948 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | methyl 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H35NO3/c1-17(13-14-21-19(3)12-9-15-24(21,5)6)10-8-11-18(2)16-22(26)25-20(4)23(27)28-7/h8,10-11,13-14,16,20H,9,12,15H2,1-7H3,(H,25,26)/b11-8+,14-13+,17-10+,18-16+ |
| InChIKey | YZECAQNFXUKMNF-NBIQJRODSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|