C23H34N2O5S — CID 58619773
(2R)-3-amino-2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid (PubChem CID 58619773) has the molecular formula C23H34N2O5S and a molecular weight of 450.60 g/mol. Its IUPAC name is (2R)-3-amino-2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-3-amino-2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58619773 |
| Molecular Formula | C23H34N2O5S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2R)-3-amino-2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)N[C@@H](CS(=O)(=O)O)C(N)=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H34N2O5S/c1-16(11-12-19-18(3)10-7-13-23(19,4)5)8-6-9-17(2)14-21(26)25-20(22(24)27)15-31(28,29)30/h6,8-9,11-12,14,20H,7,10,13,15H2,1-5H3,(H2,24,27)(H,25,26)(H,28,29,30)/b9-6+,12-11+,16-8+,17-14+/t20-/m0/s1 |
| InChIKey | KFJINEFCWKSRHA-OFRYMSBASA-N |
| XLogP | 3.38 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|