C23H33NO5S — CID 90955789
(2R)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-sulfinopropanoic acid (PubChem CID 90955789) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is (2R)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-sulfinopropanoic acid.
| Compound Name | (2R)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-sulfinopropanoic acid |
|---|---|
| PubChem CID | 90955789 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | (2R)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-sulfinopropanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)N[C@@H](CS(=O)O)C(=O)O |
| InChI | InChI=1S/C23H33NO5S/c1-16(11-12-19-18(3)10-7-13-23(19,4)5)8-6-9-17(2)14-21(25)24-20(22(26)27)15-30(28)29/h6,8-9,11-12,14,20H,7,10,13,15H2,1-5H3,(H,24,25)(H,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | LVLFJEZEQWGCKK-FQEVSTJZSA-N |
| XLogP | 4.31 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|