C25H38N2O5S — CID 91568877
(2R)-3-(dimethylamino)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid (PubChem CID 91568877) has the molecular formula C25H38N2O5S and a molecular weight of 478.66 g/mol. Its IUPAC name is (2R)-3-(dimethylamino)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid.
| Compound Name | (2R)-3-(dimethylamino)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 91568877 |
| Molecular Formula | C25H38N2O5S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (2R)-3-(dimethylamino)-2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-oxopropane-1-sulfonic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)N[C@@H](CS(=O)(=O)O)C(=O)N(C)C |
| InChI | InChI=1S/C25H38N2O5S/c1-18(13-14-21-20(3)12-9-15-25(21,4)5)10-8-11-19(2)16-23(28)26-22(17-33(30,31)32)24(29)27(6)7/h8,10-11,13-14,16,22H,9,12,15,17H2,1-7H3,(H,26,28)(H,30,31,32)/t22-/m0/s1 |
| InChIKey | LMYFFDZIBBCDCT-QFIPXVFZSA-N |
| XLogP | 3.98 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|