C29H37NO2 — CID 135384966
(2E,4E,6Z,8E)-N,3,7-trimethyl-N-phenacyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 135384966) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-N,3,7-trimethyl-N-phenacyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6Z,8E)-N,3,7-trimethyl-N-phenacyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 135384966 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (2E,4E,6Z,8E)-N,3,7-trimethyl-N-phenacyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\C(=O)N(C)CC(=O)c2ccccc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H37NO2/c1-22(17-18-26-24(3)14-11-19-29(26,4)5)12-10-13-23(2)20-28(32)30(6)21-27(31)25-15-8-7-9-16-25/h7-10,12-13,15-18,20H,11,14,19,21H2,1-6H3/b13-10+,18-17+,22-12-,23-20+ |
| InChIKey | PTJCWBPJYCVKTA-AMOGGYIESA-N |
| XLogP | 6.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|