C38H42BrOP — CID 88823726
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide (PubChem CID 88823726) has the molecular formula C38H42BrOP and a molecular weight of 625.63 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 88823726 |
| Molecular Formula | C38H42BrOP |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)CCC1.[Br-] |
| InChI | InChI=1S/C38H42OP.BrH/c1-30(26-27-36-32(3)19-16-28-38(36,4)5)17-15-18-31(2)29-37(39)40(33-20-9-6-10-21-33,34-22-11-7-12-23-34)35-24-13-8-14-25-35;/h6-15,17-18,20-27,29H,16,19,28H2,1-5H3;1H/q+1;/p-1/b18-15+,27-26+,30-17+,31-29+; |
| InChIKey | KRNTVCQPGDZUEP-NWSYAUATSA-M |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|