C38H42O2P+ — CID 21318250
[(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium (PubChem CID 21318250) has the molecular formula C38H42O2P+ and a molecular weight of 561.73 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium.
| Compound Name | [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 21318250 |
| Molecular Formula | C38H42O2P+ |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)CC(O)C1 |
| InChI | InChI=1S/C38H42O2P/c1-29(24-25-36-31(3)27-32(39)28-38(36,4)5)16-15-17-30(2)26-37(40)41(33-18-9-6-10-19-33,34-20-11-7-12-21-34)35-22-13-8-14-23-35/h6-26,32,39H,27-28H2,1-5H3/q+1/b17-15+,25-24+,29-16+,30-26+ |
| InChIKey | KOXOUPSHBRYLLT-CCVRBEQRSA-N |
| XLogP | 8.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|