C38H42BrO2P — CID 21318249
[(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide (PubChem CID 21318249) has the molecular formula C38H42BrO2P and a molecular weight of 641.63 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide.
| Compound Name | [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 21318249 |
| Molecular Formula | C38H42BrO2P |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | [(2E,4E,6E,8E)-9-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]-triphenylphosphanium bromide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(C)(C)CC(O)C1.[Br-] |
| InChI | InChI=1S/C38H42O2P.BrH/c1-29(24-25-36-31(3)27-32(39)28-38(36,4)5)16-15-17-30(2)26-37(40)41(33-18-9-6-10-19-33,34-20-11-7-12-21-34)35-22-13-8-14-23-35;/h6-26,32,39H,27-28H2,1-5H3;1H/q+1;/p-1/b17-15+,25-24+,29-16+,30-26+; |
| InChIKey | SRZREJQPYTUHHY-XQVGBRHHSA-M |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|