C25H36O4 — CID 173293809
3-[(2E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy-2,2-dimethylpropanoic acid (PubChem CID 173293809) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(2E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 173293809 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-[(2E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxy-2,2-dimethylpropanoic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=C/C(C)=C/C(=O)OCC(C)(C)C(=O)O |
| InChI | InChI=1S/C25H36O4/c1-18(13-14-21-20(3)12-9-15-24(21,4)5)10-8-11-19(2)16-22(26)29-17-25(6,7)23(27)28/h8,10-11,13-14,16H,9,12,15,17H2,1-7H3,(H,27,28)/b11-8?,14-13?,18-10?,19-16+ |
| InChIKey | LEZHYILUNLEMGR-ZOJZKLBGSA-N |
| XLogP | 6.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|