C27H33N3O4 — CID 123635981
2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-nitrobenzamide (PubChem CID 123635981) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-nitrobenzamide.
| Compound Name | 2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 123635981 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 2-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-nitrobenzamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1cc([N+](=O)[O-])ccc1C(N)=O |
| InChI | InChI=1S/C27H33N3O4/c1-18(11-14-23-20(3)10-7-15-27(23,4)5)8-6-9-19(2)16-25(31)29-24-17-21(30(33)34)12-13-22(24)26(28)32/h6,8-9,11-14,16-17H,7,10,15H2,1-5H3,(H2,28,32)(H,29,31) |
| InChIKey | OQPZCDOJXAPHPP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|