C30H39NO4 — CID 173212510
2-[2-[[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl]butanoic acid (PubChem CID 173212510) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[2-[[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl]butanoic acid.
| Compound Name | 2-[2-[[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 173212510 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 2-[2-[[(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1cc(O)ccc1NC(=O)/C=C(C)/C=C/C=C(\C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H39NO4/c1-7-24(29(34)35)25-19-23(32)14-16-27(25)31-28(33)18-21(3)11-8-10-20(2)13-15-26-22(4)12-9-17-30(26,5)6/h8,10-11,13-16,18-19,24,32H,7,9,12,17H2,1-6H3,(H,31,33)(H,34,35)/b11-8+,15-13?,20-10+,21-18+ |
| InChIKey | MMVIXISTXRKMEW-OSFUVNPASA-N |
| XLogP | 7.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|