C28H35NO4 — CID 87584664
2-[3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-hydroxyphenyl]acetic acid (PubChem CID 87584664) has the molecular formula C28H35NO4 and a molecular weight of 449.59 g/mol. Its IUPAC name is 2-[3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 87584664 |
| Molecular Formula | C28H35NO4 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 2-[3-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-4-hydroxyphenyl]acetic acid |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1cc(CC(=O)O)ccc1O |
| InChI | InChI=1S/C28H35NO4/c1-19(11-13-23-21(3)10-7-15-28(23,4)5)8-6-9-20(2)16-26(31)29-24-17-22(18-27(32)33)12-14-25(24)30/h6,8-9,11-14,16-17,30H,7,10,15,18H2,1-5H3,(H,29,31)(H,32,33) |
| InChIKey | QNWDIKWLLYWCGQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|