C27H32F3NO2 — CID 75067535
N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 75067535) has the molecular formula C27H32F3NO2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 75067535 |
| Molecular Formula | C27H32F3NO2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C27H32F3NO2/c1-18(11-13-22-20(3)10-7-15-26(22,4)5)8-6-9-19(2)16-25(33)31-23-17-21(27(28,29)30)12-14-24(23)32/h6,8-9,11-14,16-17,32H,7,10,15H2,1-5H3,(H,31,33) |
| InChIKey | WJGOWSPXLKOYLH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|