C30H39NO5 — CID 87659677
[2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl] 3-hydroxybutanoate (PubChem CID 87659677) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is [2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl] 3-hydroxybutanoate.
| Compound Name | [2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 87659677 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | [2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-5-hydroxyphenyl] 3-hydroxybutanoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(O)cc2OC(=O)CC(C)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H39NO5/c1-20(12-14-25-22(3)11-8-16-30(25,5)6)9-7-10-21(2)17-28(34)31-26-15-13-24(33)19-27(26)36-29(35)18-23(4)32/h7,9-10,12-15,17,19,23,32-33H,8,11,16,18H2,1-6H3,(H,31,34)/b10-7+,14-12+,20-9+,21-17+ |
| InChIKey | FLSCVWKGVXYHGZ-IGHSUZHJSA-N |
| XLogP | 6.54 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|