C30H39NO4 — CID 91209347
[4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] 3-hydroxybutanoate (PubChem CID 91209347) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] 3-hydroxybutanoate.
| Compound Name | [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] 3-hydroxybutanoate |
|---|---|
| PubChem CID | 91209347 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] 3-hydroxybutanoate |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1ccc(OC(=O)CC(C)O)cc1 |
| InChI | InChI=1S/C30H39NO4/c1-21(12-17-27-23(3)11-8-18-30(27,5)6)9-7-10-22(2)19-28(33)31-25-13-15-26(16-14-25)35-29(34)20-24(4)32/h7,9-10,12-17,19,24,32H,8,11,18,20H2,1-6H3,(H,31,33) |
| InChIKey | CUOBTWCFJMVGGW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|