C32H43NO5 — CID 10391981
(2E,4E,6E,8E)-3,7-dimethyl-N-[4-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]methyl]phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 10391981) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-N-[4-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]methyl]phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-N-[4-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]methyl]phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 10391981 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-N-[4-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]methyl]phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(C[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H43NO5/c1-21(11-16-26-23(3)10-7-17-32(26,4)5)8-6-9-22(2)18-29(35)33-25-14-12-24(13-15-25)19-28-31(37)30(36)27(34)20-38-28/h6,8-9,11-16,18,27-28,30-31,34,36-37H,7,10,17,19-20H2,1-5H3,(H,33,35)/b9-6+,16-11+,21-8+,22-18+/t27-,28+,30+,31+/m1/s1 |
| InChIKey | GHGPGAQLXIVZGQ-NUFFLHBKSA-N |
| XLogP | 5.18 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|