C32H41NO7 — CID 10370355
(2R,3R,4S,5S)-6-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 10370355) has the molecular formula C32H41NO7 and a molecular weight of 551.68 g/mol. Its IUPAC name is (2R,3R,4S,5S)-6-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,3R,4S,5S)-6-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10370355 |
| Molecular Formula | C32H41NO7 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | (2R,3R,4S,5S)-6-[4-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(C3O[C@@H](C(=O)O)[C@H](O)[C@@H](O)[C@@H]3O)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H41NO7/c1-19(11-16-24-21(3)10-7-17-32(24,4)5)8-6-9-20(2)18-25(34)33-23-14-12-22(13-15-23)29-27(36)26(35)28(37)30(40-29)31(38)39/h6,8-9,11-16,18,26-30,35-37H,7,10,17H2,1-5H3,(H,33,34)(H,38,39)/b9-6+,16-11+,19-8+,20-18+/t26-,27-,28+,29?,30+/m0/s1 |
| InChIKey | OGINTWHYBKABMG-UPTYHLSISA-N |
| XLogP | 4.76 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|