C29H40NO5P — CID 91275637
[4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] propyl hydrogen phosphate (PubChem CID 91275637) has the molecular formula C29H40NO5P and a molecular weight of 513.62 g/mol. Its IUPAC name is [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] propyl hydrogen phosphate.
| Compound Name | [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] propyl hydrogen phosphate |
|---|---|
| PubChem CID | 91275637 |
| Molecular Formula | C29H40NO5P |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | [4-[[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]phenyl] propyl hydrogen phosphate |
| SMILES | CCCOP(=O)(O)Oc1ccc(NC(=O)C=C(C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C)cc1 |
| InChI | InChI=1S/C29H40NO5P/c1-7-20-34-36(32,33)35-26-16-14-25(15-17-26)30-28(31)21-23(3)11-8-10-22(2)13-18-27-24(4)12-9-19-29(27,5)6/h8,10-11,13-18,21H,7,9,12,19-20H2,1-6H3,(H,30,31)(H,32,33) |
| InChIKey | UADTXVGGXNJYSZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|