C31H41NO4 — CID 87659509
[5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-2-methoxyphenyl] butanoate (PubChem CID 87659509) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is [5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-2-methoxyphenyl] butanoate.
| Compound Name | [5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-2-methoxyphenyl] butanoate |
|---|---|
| PubChem CID | 87659509 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | [5-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-2-methoxyphenyl] butanoate |
| SMILES | CCCC(=O)Oc1cc(NC(=O)/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)ccc1OC |
| InChI | InChI=1S/C31H41NO4/c1-8-11-30(34)36-28-21-25(16-18-27(28)35-7)32-29(33)20-23(3)13-9-12-22(2)15-17-26-24(4)14-10-19-31(26,5)6/h9,12-13,15-18,20-21H,8,10-11,14,19H2,1-7H3,(H,32,33)/b13-9+,17-15+,22-12+,23-20+ |
| InChIKey | OLZKMIHXMHDQFF-ICHCOKHNSA-N |
| XLogP | 7.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|