C27H32F3NO — CID 75059749
3,7-dimethyl-N-[3-(trifluoromethyl)phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 75059749) has the molecular formula C27H32F3NO and a molecular weight of 443.55 g/mol. Its IUPAC name is 3,7-dimethyl-N-[3-(trifluoromethyl)phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | 3,7-dimethyl-N-[3-(trifluoromethyl)phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 75059749 |
| Molecular Formula | C27H32F3NO |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3,7-dimethyl-N-[3-(trifluoromethyl)phenyl]-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H32F3NO/c1-19(14-15-24-21(3)11-8-16-26(24,4)5)9-6-10-20(2)17-25(32)31-23-13-7-12-22(18-23)27(28,29)30/h6-7,9-10,12-15,17-18H,8,11,16H2,1-5H3,(H,31,32) |
| InChIKey | XGSMEEHHAVIWPH-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|