C19H22F3NO — CID 24760851
(E)-N-[4-(trifluoromethyl)phenyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide (PubChem CID 24760851) has the molecular formula C19H22F3NO and a molecular weight of 337.39 g/mol. Its IUPAC name is (E)-N-[4-(trifluoromethyl)phenyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(trifluoromethyl)phenyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 24760851 |
| Molecular Formula | C19H22F3NO |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (E)-N-[4-(trifluoromethyl)phenyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
| SMILES | CC1=C(/C=C/C(=O)Nc2ccc(C(F)(F)F)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H22F3NO/c1-13-5-4-12-18(2,3)16(13)10-11-17(24)23-15-8-6-14(7-9-15)19(20,21)22/h6-11H,4-5,12H2,1-3H3,(H,23,24)/b11-10+ |
| InChIKey | KIJOAIYHASMUMU-ZHACJKMWSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|