C17H21ClN2O — CID 67089142
N-(5-chloro-2-pyridinyl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide (PubChem CID 67089142) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67089142 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
| SMILES | CC1=C(C=CC(=O)Nc2ccc(Cl)cn2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H21ClN2O/c1-12-5-4-10-17(2,3)14(12)7-9-16(21)20-15-8-6-13(18)11-19-15/h6-9,11H,4-5,10H2,1-3H3,(H,19,20,21) |
| InChIKey | XDYMPZNKQAKYFJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|