About N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane
N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane (PubChem CID 153335046) has the molecular formula C10H13ClN2O3
and a molecular weight of 244.68 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane.
Molecular Properties
| Compound Name | N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane |
| PubChem CID | 153335046 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane |
| SMILES | CCOC.O=CC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C7H5ClN2O2.C3H8O/c8-5-1-2-6(9-3-5)10-7(12)4-11;1-3-4-2/h1-4H,(H,9,10,12);3H2,1-2H3 |
| InChIKey | TXTMSNJYHNHALG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane?
The IUPAC name of N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane (CID 153335046) is N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane.
What is the SMILES notation for N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane?
The canonical SMILES for N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane is CCOC.O=CC(=O)Nc1ccc(Cl)cn1.
What is the InChIKey of N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane?
The InChIKey is TXTMSNJYHNHALG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O2.C3H8O/c8-5-1-2-6(9-3-5)10-7(12)4-11;1-3-4-2/h1-4H,(H,9,10,12);3H2,1-2H3.
What are the key properties of N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane?
N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane has a molecular weight of 244.68 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2-pyridinyl)-2-oxoacetamide;methoxyethane is sourced from PubChem (CID 153335046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).