C11H14ClN3O3 — CID 44996125
N-(5-chloro-2-pyridinyl)-N'-(1-methoxypropan-2-yl)oxamide (PubChem CID 44996125) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-N'-(1-methoxypropan-2-yl)oxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-N'-(1-methoxypropan-2-yl)oxamide |
|---|---|
| PubChem CID | 44996125 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-N'-(1-methoxypropan-2-yl)oxamide |
| SMILES | COCC(C)NC(=O)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C11H14ClN3O3/c1-7(6-18-2)14-10(16)11(17)15-9-4-3-8(12)5-13-9/h3-5,7H,6H2,1-2H3,(H,14,16)(H,13,15,17) |
| InChIKey | RZNJSABGAGYYBN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|