C13H18N2O3S — CID 51470310
N'-[(2R)-1-methoxypropan-2-yl]-N-(2-methylsulfanylphenyl)oxamide (PubChem CID 51470310) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is N'-[(2R)-1-methoxypropan-2-yl]-N-(2-methylsulfanylphenyl)oxamide.
| Compound Name | N'-[(2R)-1-methoxypropan-2-yl]-N-(2-methylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 51470310 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N'-[(2R)-1-methoxypropan-2-yl]-N-(2-methylsulfanylphenyl)oxamide |
| SMILES | COC[C@@H](C)NC(=O)C(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C13H18N2O3S/c1-9(8-18-2)14-12(16)13(17)15-10-6-4-5-7-11(10)19-3/h4-7,9H,8H2,1-3H3,(H,14,16)(H,15,17)/t9-/m1/s1 |
| InChIKey | CMSKZLVHHJFFID-SECBINFHSA-N |
| XLogP | 1.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|