C19H24ClNO — CID 67089131
N-[(4-chlorophenyl)methyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide (PubChem CID 67089131) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67089131 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enamide |
| SMILES | CC1=C(C=CC(=O)NCc2ccc(Cl)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H24ClNO/c1-14-5-4-12-19(2,3)17(14)10-11-18(22)21-13-15-6-8-16(20)9-7-15/h6-11H,4-5,12-13H2,1-3H3,(H,21,22) |
| InChIKey | BFOQQLDJCLWJKB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|