C17H24N2O — CID 67566143
pyrazine;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 67566143) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is pyrazine;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
| Compound Name | pyrazine;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 67566143 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | pyrazine;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=C(C)CCCC1(C)C.c1cnccn1 |
| InChI | InChI=1S/C13H20O.C4H4N2/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;1-2-6-4-3-5-1/h7-8H,5-6,9H2,1-4H3;1-4H/b8-7+; |
| InChIKey | NIRNLFNIWXVJRY-USRGLUTNSA-N |
| XLogP | 4.13 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|