C30H44 — CID 54413330
2-[3,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 54413330) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is 2-[3,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[3,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 54413330 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 2-[3,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C30H44/c1-23(17-19-27-25(3)15-11-21-29(27,5)6)13-9-10-14-24(2)18-20-28-26(4)16-12-22-30(28,7)8/h9-10,13-14,17-20H,11-12,15-16,21-22H2,1-8H3 |
| InChIKey | VVRHRSYNKFZXFD-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|