C19H27Cl — CID 134395769
2-[(1E,3Z,5E,7E)-8-chloro-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene (PubChem CID 134395769) has the molecular formula C19H27Cl and a molecular weight of 290.88 g/mol. Its IUPAC name is 2-[(1E,3Z,5E,7E)-8-chloro-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3Z,5E,7E)-8-chloro-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 134395769 |
| Molecular Formula | C19H27Cl |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[(1E,3Z,5E,7E)-8-chloro-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C\C=C\C(C)=C\Cl)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H27Cl/c1-15(8-6-9-16(2)14-20)11-12-18-17(3)10-7-13-19(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3/b9-6+,12-11+,15-8-,16-14+ |
| InChIKey | VQRPOOQLYFPPNK-ZVCIMWCZSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|