C20H28OPb — CID 173018096
CID 173018096 (PubChem CID 173018096) has the molecular formula C20H28OPb and a molecular weight of 491.64 g/mol.
| Compound Name | CID 173018096 |
|---|---|
| PubChem CID | 173018096 |
| Molecular Formula | C20H28OPb |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | — |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)CCCC1(C)C)=CC=O.[Pb] |
| InChI | InChI=1S/C20H28O.Pb/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5;/h6,8-9,11-13,15H,7,10,14H2,1-5H3; |
| InChIKey | DPRCBHHOEMFJCV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|