C35H48 — CID 100983894
1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16,20-pentamethylhenicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]cyclohexene (PubChem CID 100983894) has the molecular formula C35H48 and a molecular weight of 468.77 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16,20-pentamethylhenicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16,20-pentamethylhenicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]cyclohexene |
|---|---|
| PubChem CID | 100983894 |
| Molecular Formula | C35H48 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16,20-pentamethylhenicosa-1,3,5,7,9,11,13,15,17,19-decaenyl]cyclohexene |
| SMILES | CC(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C35H48/c1-28(2)16-12-19-31(5)22-13-20-29(3)17-10-11-18-30(4)21-14-23-32(6)25-26-34-33(7)24-15-27-35(34,8)9/h10-14,16-23,25-26H,15,24,27H2,1-9H3/b11-10+,19-12+,20-13+,21-14+,26-25+,29-17+,30-18+,31-22+,32-23+ |
| InChIKey | UJOPNXNMWMIFKW-IMJSKIKYSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|