C36H52 — CID 102148044
1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,8,12-tetramethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]cyclohexene (PubChem CID 102148044) has the molecular formula C36H52 and a molecular weight of 484.81 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,8,12-tetramethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,8,12-tetramethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]cyclohexene |
|---|---|
| PubChem CID | 102148044 |
| Molecular Formula | C36H52 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.41 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,7,8,12-tetramethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C36H52/c1-27(21-23-33-31(5)19-13-25-35(33,7)8)15-11-17-29(3)30(4)18-12-16-28(2)22-24-34-32(6)20-14-26-36(34,9)10/h11-12,15-18,21-24H,13-14,19-20,25-26H2,1-10H3/b17-11+,18-12+,23-21+,24-22+,27-15+,28-16+,30-29+ |
| InChIKey | WMIVHIPNRCILEG-YMYOPPPOSA-N |
| XLogP | 11.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|