C21H29N — CID 10541933
(2E,4E,6E,8E)-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile (PubChem CID 10541933) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is (2E,4E,6E,8E)-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile.
| Compound Name | (2E,4E,6E,8E)-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 10541933 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (2E,4E,6E,8E)-2,3,7-trimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenenitrile |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C(\C)C#N)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H29N/c1-16(9-7-10-17(2)19(4)15-22)12-13-20-18(3)11-8-14-21(20,5)6/h7,9-10,12-13H,8,11,14H2,1-6H3/b10-7+,13-12+,16-9+,19-17+ |
| InChIKey | ANMKZXJBUDEALB-FPDDBDNFSA-N |
| XLogP | 6.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|