C22H36 — CID 142018580
2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene;ethane (PubChem CID 142018580) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene;ethane.
| Compound Name | 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene;ethane |
|---|---|
| PubChem CID | 142018580 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3,3-trimethylcyclohexene;ethane |
| SMILES | C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C.CC |
| InChI | InChI=1S/C20H30.C2H6/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6;1-2/h7-8,10-11,13-14H,9,12,15H2,1-6H3;1-2H3/b10-8+,14-13+,16-7+,17-11+; |
| InChIKey | YJCAGMGVNGZUQY-MUSVFKGGSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|