C19H25N3O — CID 92856197
N-[(Z)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 92856197) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(Z)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 92856197 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(Z)-[(Z)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | CC1=C(/C=C\C(C)=N/NC(=O)c2ccncc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H25N3O/c1-14-6-5-11-19(3,4)17(14)8-7-15(2)21-22-18(23)16-9-12-20-13-10-16/h7-10,12-13H,5-6,11H2,1-4H3,(H,22,23)/b8-7-,21-15- |
| InChIKey | DVRXMZOCRXBBNX-YPGPPQOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|