About [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea
[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea (PubChem CID 3286029) has the molecular formula C14H23N3S
and a molecular weight of 265.43 g/mol. Its IUPAC name is [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea.
Molecular Properties
| Compound Name | [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea |
| PubChem CID | 3286029 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=NNC(N)=S |
| InChI | InChI=1S/C14H23N3S/c1-10-6-5-9-14(3,4)12(10)8-7-11(2)16-17-13(15)18/h7-8H,5-6,9H2,1-4H3,(H3,15,17,18) |
| InChIKey | HIWGVXBHBZVTTC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea?
The IUPAC name of [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea (CID 3286029) is [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea.
What is the SMILES notation for [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea?
The canonical SMILES for [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea is CC(C=CC1=C(C)CCCC1(C)C)=NNC(N)=S.
What is the InChIKey of [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea?
The InChIKey is HIWGVXBHBZVTTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3S/c1-10-6-5-9-14(3,4)12(10)8-7-11(2)16-17-13(15)18/h7-8H,5-6,9H2,1-4H3,(H3,15,17,18).
What are the key properties of [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea?
[4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea has a molecular weight of 265.43 g/mol, XLogP of 3.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylideneamino]thiourea is sourced from PubChem (CID 3286029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).