C22H33N — CID 146240318
(1E,3E,5Z,7E)-3,7,9-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaen-5-amine (PubChem CID 146240318) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is (1E,3E,5Z,7E)-3,7,9-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaen-5-amine.
| Compound Name | (1E,3E,5Z,7E)-3,7,9-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaen-5-amine |
|---|---|
| PubChem CID | 146240318 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (1E,3E,5Z,7E)-3,7,9-trimethyl-1-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaen-5-amine |
| SMILES | C=C(C)/C=C(C)/C=C(N)/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H33N/c1-16(2)13-18(4)15-20(23)14-17(3)10-11-21-19(5)9-8-12-22(21,6)7/h10-11,13-15H,1,8-9,12,23H2,2-7H3/b11-10+,17-14+,18-13+,20-15- |
| InChIKey | QXNLRPSWQHSPDF-IEPAELGKSA-N |
| XLogP | 6.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|